Compound Q&A

How is 1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5) typically synthesized?

Answer

1-Bromo-3-fluoro-2-nitrobenzene
1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5) is synthesized by bromination of 3-fluoro-2-nitrobenzene with bromine in the presence of a phase transfer catalyst, such as tetra-n-butylammonium bromide. The reaction is typically conducted in a non-aqueous solvent like acetonitrile or N,N-dimethylformamide (DMF). The yield is usually high, and the product is isolated by recrystallization or distillation.

About

English Name 1-Bromo-3-fluoro-2-nitrobenzene
Molecular Formula C6H3BrFNO2
Molecular Weight 220 g/mol
SMILES C1=CC(=C(C(=C1)Br)[N+](=O)[O-])F
InChIKey VFPAOFBPEYCAAZ-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5)?

1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5) is a crystalline compound with a molecular weight...

Compound Q&A

What industries use 1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5)?

1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5) is used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling 1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5)?

When handling 1-Bromo-3-fluoro-2-nitrobenzene (CAS: 886762-70-5), appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...