Compound Q&A

What industries use Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) (CAS: 155090-83-8)?

Answer

Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine)
Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) is used in various industries. It is widely utilized in the pharmaceutical sector for drug delivery systems and sensors. In the polymer industry, it serves as a functional monomer for developing advanced polymers. Additionally, it finds applications in semiconductor industry for the production of electronic materials and devices.

About

English Name Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine)
Molecular Formula C14H14O5S2
Molecular Weight 326.4 g/mol
SMILES O=S(/C=C/C1=CC=CC=C1)(O)=O.C23=CSC=C2OCCO3
InChIKey BGAWZPQKJPTIEA-UHDJGPCESA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) (CAS: 155090-83-8)?

Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) is a polymer wi...

Compound Q&A

How is Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) (CAS: 155090-83-8) typically synthesized?

Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) is synthesized ...

Compound Q&A

What precautions should be taken when handling Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) (CAS: 155090-83-8)?

When handling Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...