Compound Q&A

How is Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) (CAS: 155090-83-8) typically synthesized?

Answer

Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine)
Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) is synthesized through a condensation polymerization process. The monomer is typically prepared via a Friedel-Crafts alkylation followed by sulfonation. The polymerization is catalyzed by strong acids, and the reaction is carried out in an inert atmosphere to avoid side reactions. The yield is generally high, and the product is purified by precipitation and filtration.

About

English Name Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine)
Molecular Formula C14H14O5S2
Molecular Weight 326.4 g/mol
SMILES O=S(/C=C/C1=CC=CC=C1)(O)=O.C23=CSC=C2OCCO3
InChIKey BGAWZPQKJPTIEA-UHDJGPCESA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) (CAS: 155090-83-8)?

Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) is a polymer wi...

Compound Q&A

What industries use Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) (CAS: 155090-83-8)?

Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) is used in vari...

Compound Q&A

What precautions should be taken when handling Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) (CAS: 155090-83-8)?

When handling Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...