Compound Q&A

What are the physical and chemical properties of Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) (CAS: 155090-83-8)?

Answer

Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine)
Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) is a polymer with a high molecular weight, typically above 10,000 g/mol. It exhibits excellent solubility in polar solvents such as water and alcohols. Chemically, it is highly reactive, particularly towards nucleophiles and reducing agents. Its crystalline form is stable under normal conditions, but it can be dissolved in water to form a conductive solution.

About

English Name Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine)
Molecular Formula C14H14O5S2
Molecular Weight 326.4 g/mol
SMILES O=S(/C=C/C1=CC=CC=C1)(O)=O.C23=CSC=C2OCCO3
InChIKey BGAWZPQKJPTIEA-UHDJGPCESA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) (CAS: 155090-83-8) typically synthesized?

Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) is synthesized ...

Compound Q&A

What industries use Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) (CAS: 155090-83-8)?

Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) is used in vari...

Compound Q&A

What precautions should be taken when handling Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine) (CAS: 155090-83-8)?

When handling Poly(2-phenylethenesulfonic acid compound with 2,3-dihydrothieno[3,4-b][1,4]dioxine), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...