Compound Q&A

How is 2-Fluoro-6-hydroxybenzoic acid (CAS: 67531-86-6) typically synthesized?

Answer

2-Fluoro-6-hydroxybenzoic acid
2-Fluoro-6-hydroxybenzoic acid can be synthesized through the reaction of 6-hydroxybenzoic acid with hydrogen fluoride in the presence of a suitable catalyst such as anhydrous zinc chloride. The process involves the introduction of a fluorine atom at the 2-position, followed by isolation and purification of the product.

About

CAS No 67531-86-6
English Name 2-Fluoro-6-hydroxybenzoic acid
Molecular Formula C7H5FO3
Molecular Weight 156.11 g/mol
SMILES C1=CC(=C(C(=C1)F)C(=O)O)O
InChIKey BCEKGWWLVKXZKK-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-6-hydroxybenzoic acid (CAS: 67531-86-6)?

2-Fluoro-6-hydroxybenzoic acid is a white or off-white crystalline solid with a molecular weight of ...

Compound Q&A

What industries use 2-Fluoro-6-hydroxybenzoic acid (CAS: 67531-86-6)?

2-Fluoro-6-hydroxybenzoic acid finds application in pharmaceuticals, where it can be used as a precu...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-6-hydroxybenzoic acid (CAS: 67531-86-6)?

When handling 2-Fluoro-6-hydroxybenzoic acid, it is crucial to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...