Compound Q&A

What are the physical and chemical properties of 2-Fluoro-6-hydroxybenzoic acid (CAS: 67531-86-6)?

Answer

2-Fluoro-6-hydroxybenzoic acid
2-Fluoro-6-hydroxybenzoic acid is a white or off-white crystalline solid with a molecular weight of approximately 172.05 g/mol. It is slightly soluble in water and more soluble in organic solvents like methanol and ethanol. Chemically, it is reactive towards bases and can undergo esterification and amide formation reactions.

About

CAS No 67531-86-6
English Name 2-Fluoro-6-hydroxybenzoic acid
Molecular Formula C7H5FO3
Molecular Weight 156.11 g/mol
SMILES C1=CC(=C(C(=C1)F)C(=O)O)O
InChIKey BCEKGWWLVKXZKK-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 2-Fluoro-6-hydroxybenzoic acid (CAS: 67531-86-6) typically synthesized?

2-Fluoro-6-hydroxybenzoic acid can be synthesized through the reaction of 6-hydroxybenzoic acid with...

Compound Q&A

What industries use 2-Fluoro-6-hydroxybenzoic acid (CAS: 67531-86-6)?

2-Fluoro-6-hydroxybenzoic acid finds application in pharmaceuticals, where it can be used as a precu...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-6-hydroxybenzoic acid (CAS: 67531-86-6)?

When handling 2-Fluoro-6-hydroxybenzoic acid, it is crucial to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...