Compound Q&A

What precautions should be taken when handling Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) (CAS: 4826-71-5)?

Answer

Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1)
Handling Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) requires appropriate personal protective equipment (PPE) such as gloves and safety goggles. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risk. Spills should be cleaned up using appropriate absorbents, and the area should be thoroughly washed. Always refer to the Safety Data Sheet (SDS) for detailed safety information.

About

CAS No 4826-71-5
English Name Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1)
Molecular Formula C5H13CaClNO4P
Molecular Weight 257.66 g/mol
SMILES C[N+](C)(C)CCOP(=O)([O-])[O-].[Cl-].[Ca+2]
InChIKey ICVPTJCCKTXCDT-UHFFFAOYSA-L
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) (CAS: 4826-71-5)?

Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) is a crystalline compound with a molecu...

Compound Q&A

How is Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) (CAS: 4826-71-5) typically synthesized?

Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) is typically synthesized through the re...

Compound Q&A

What industries use Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) (CAS: 4826-71-5)?

Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) is used in various industries including...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...