Compound Q&A

What industries use Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) (CAS: 4826-71-5)?

Answer

Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1)
Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) is used in various industries including pharmaceuticals, where it serves as a stabilizer and excipient; polymers, where it acts as a compatibilizer; sensors, where it enhances sensitivity; and semiconductors, where it improves material properties. It is also utilized in agricultural and food industries for similar applications.

About

CAS No 4826-71-5
English Name Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1)
Molecular Formula C5H13CaClNO4P
Molecular Weight 257.66 g/mol
SMILES C[N+](C)(C)CCOP(=O)([O-])[O-].[Cl-].[Ca+2]
InChIKey ICVPTJCCKTXCDT-UHFFFAOYSA-L
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) (CAS: 4826-71-5)?

Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) is a crystalline compound with a molecu...

Compound Q&A

How is Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) (CAS: 4826-71-5) typically synthesized?

Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) is typically synthesized through the re...

Compound Q&A

What precautions should be taken when handling Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) (CAS: 4826-71-5)?

Handling Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) requires appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...