Compound Q&A

What are the physical and chemical properties of Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) (CAS: 4826-71-5)?

Answer

Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1)
Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) is a crystalline compound with a molecular weight of approximately 394.32 g/mol. It is soluble in water and has limited solubility in organic solvents. Chemically, it exhibits moderate reactivity with acids and bases. It is stable under normal conditions but may react with moisture to form phosphoric acid and calcium hydroxide.

About

CAS No 4826-71-5
English Name Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1)
Molecular Formula C5H13CaClNO4P
Molecular Weight 257.66 g/mol
SMILES C[N+](C)(C)CCOP(=O)([O-])[O-].[Cl-].[Ca+2]
InChIKey ICVPTJCCKTXCDT-UHFFFAOYSA-L
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) (CAS: 4826-71-5) typically synthesized?

Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) is typically synthesized through the re...

Compound Q&A

What industries use Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) (CAS: 4826-71-5)?

Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) is used in various industries including...

Compound Q&A

What precautions should be taken when handling Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) (CAS: 4826-71-5)?

Handling Calcium chloride 2-(trimethylammonio)ethyl phosphate (1:1:1) requires appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...