Compound Q&A

What precautions should be taken when handling Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8)?

Answer

Bis(4-nitrophenyl) hydrogen phosphate
When handling Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8), it is crucial to use proper personal protective equipment (PPE) such as gloves, goggles, and lab coats. Ensure that the work is conducted in a well-ventilated fume hood to minimize exposure to airborne particles. Spills should be cleaned up using appropriate absorbent materials and the area should be rinsed with water. In case of contact with the skin or eyes, flush with water immediately and seek medical attention. Always refer to the Safety Data Sheet (SDS) for detailed information on handling and storage.

About

CAS No 645-15-8
English Name Bis(4-nitrophenyl) hydrogen phosphate
Molecular Formula C12H9N2O8P
Molecular Weight 340.18 g/mol
SMILES C1=CC(=CC=C1[N+](=O)[O-])OP(=O)(O)OC2=CC=C(C=C2)[N+](=O)[O-]
InChIKey MHSVUSZEHNVFKW-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8)?

Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8) is a crystalline compound with a molecular wei...

Compound Q&A

How is Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8) typically synthesized?

Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8) is typically synthesized by the reaction of 4-...

Compound Q&A

What industries use Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8)?

Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8) is primarily used in the pharmaceutical indust...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...