Compound Q&A

What are the physical and chemical properties of Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8)?

Answer

Bis(4-nitrophenyl) hydrogen phosphate
Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8) is a crystalline compound with a molecular weight of approximately 296.12 g/mol. It is moderately soluble in water and less soluble in organic solvents. The compound is known for its low reactivity under normal conditions but can be sensitive to strong acids and bases. It has a melting point of around 235°C and a density of approximately 1.5 g/cm³.

About

CAS No 645-15-8
English Name Bis(4-nitrophenyl) hydrogen phosphate
Molecular Formula C12H9N2O8P
Molecular Weight 340.18 g/mol
SMILES C1=CC(=CC=C1[N+](=O)[O-])OP(=O)(O)OC2=CC=C(C=C2)[N+](=O)[O-]
InChIKey MHSVUSZEHNVFKW-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8) typically synthesized?

Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8) is typically synthesized by the reaction of 4-...

Compound Q&A

What industries use Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8)?

Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8) is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8)?

When handling Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8), it is crucial to use proper per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...