Compound Q&A

What industries use Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8)?

Answer

Bis(4-nitrophenyl) hydrogen phosphate
Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8) is primarily used in the pharmaceutical industry, where it serves as a precursor for the synthesis of certain drugs. It is also utilized in the polymer industry as a stabilizer and in the sensor industry for the detection of specific chemical species. Additionally, it has applications in the semiconductor industry as a dopant for certain materials.

About

CAS No 645-15-8
English Name Bis(4-nitrophenyl) hydrogen phosphate
Molecular Formula C12H9N2O8P
Molecular Weight 340.18 g/mol
SMILES C1=CC(=CC=C1[N+](=O)[O-])OP(=O)(O)OC2=CC=C(C=C2)[N+](=O)[O-]
InChIKey MHSVUSZEHNVFKW-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8)?

Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8) is a crystalline compound with a molecular wei...

Compound Q&A

How is Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8) typically synthesized?

Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8) is typically synthesized by the reaction of 4-...

Compound Q&A

What precautions should be taken when handling Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8)?

When handling Bis(4-nitrophenyl) hydrogen phosphate (CAS: 645-15-8), it is crucial to use proper per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...