Compound Q&A

What industries use 4-Amino-N,N-diethyl-3-methylanilinium chloride (CAS: 2051-79-8)?

Answer

4-Amino-N,N-diethyl-3-methylanilinium chloride
4-Amino-N,N-diethyl-3-methylanilinium chloride finds applications in the pharmaceutical industry for intermediates in drug synthesis. It is also used in the polymer industry for functionalizing polymers and in the semiconductor industry for doping purposes. Additionally, it has potential uses in sensors due to its chemical reactivity.

About

CAS No 2051-79-8
English Name 4-Amino-N,N-diethyl-3-methylanilinium chloride
Molecular Formula C11H19ClN2
Molecular Weight 214.74 g/mol
SMILES CC[NH+](CC)c1ccc(c(c1)C)N.[Cl-]
InChIKey MPLZNPZPPXERDA-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-N,N-diethyl-3-methylanilinium chloride (CAS: 2051-79-8)?

4-Amino-N,N-diethyl-3-methylanilinium chloride is a white crystalline solid. Its molecular weight is...

Compound Q&A

How is 4-Amino-N,N-diethyl-3-methylanilinium chloride (CAS: 2051-79-8) typically synthesized?

4-Amino-N,N-diethyl-3-methylanilinium chloride is typically synthesized by reacting 3-methylaniline ...

Compound Q&A

What precautions should be taken when handling 4-Amino-N,N-diethyl-3-methylanilinium chloride (CAS: 2051-79-8)?

When handling 4-Amino-N,N-diethyl-3-methylanilinium chloride, it is important to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...