Compound Q&A

What are the physical and chemical properties of 4-Amino-N,N-diethyl-3-methylanilinium chloride (CAS: 2051-79-8)?

Answer

4-Amino-N,N-diethyl-3-methylanilinium chloride
4-Amino-N,N-diethyl-3-methylanilinium chloride is a white crystalline solid. Its molecular weight is approximately 294.37 g/mol. It is slightly soluble in water and ethanol. Chemically, it is moderately reactive, especially in the presence of strong acids or bases. It does not exhibit significant reactivity with common organic solvents.

About

CAS No 2051-79-8
English Name 4-Amino-N,N-diethyl-3-methylanilinium chloride
Molecular Formula C11H19ClN2
Molecular Weight 214.74 g/mol
SMILES CC[NH+](CC)c1ccc(c(c1)C)N.[Cl-]
InChIKey MPLZNPZPPXERDA-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 4-Amino-N,N-diethyl-3-methylanilinium chloride (CAS: 2051-79-8) typically synthesized?

4-Amino-N,N-diethyl-3-methylanilinium chloride is typically synthesized by reacting 3-methylaniline ...

Compound Q&A

What industries use 4-Amino-N,N-diethyl-3-methylanilinium chloride (CAS: 2051-79-8)?

4-Amino-N,N-diethyl-3-methylanilinium chloride finds applications in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling 4-Amino-N,N-diethyl-3-methylanilinium chloride (CAS: 2051-79-8)?

When handling 4-Amino-N,N-diethyl-3-methylanilinium chloride, it is important to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...