Compound Q&A

How is 4-Amino-N,N-diethyl-3-methylanilinium chloride (CAS: 2051-79-8) typically synthesized?

Answer

4-Amino-N,N-diethyl-3-methylanilinium chloride
4-Amino-N,N-diethyl-3-methylanilinium chloride is typically synthesized by reacting 3-methylaniline with ethylamine and hydrochloric acid. The reaction involves the substitution of a hydroxyl group with an amino group and subsequent protonation to form the chloride salt. Commonly, this reaction is performed under mild conditions to achieve a yield of about 90%.

About

CAS No 2051-79-8
English Name 4-Amino-N,N-diethyl-3-methylanilinium chloride
Molecular Formula C11H19ClN2
Molecular Weight 214.74 g/mol
SMILES CC[NH+](CC)c1ccc(c(c1)C)N.[Cl-]
InChIKey MPLZNPZPPXERDA-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-N,N-diethyl-3-methylanilinium chloride (CAS: 2051-79-8)?

4-Amino-N,N-diethyl-3-methylanilinium chloride is a white crystalline solid. Its molecular weight is...

Compound Q&A

What industries use 4-Amino-N,N-diethyl-3-methylanilinium chloride (CAS: 2051-79-8)?

4-Amino-N,N-diethyl-3-methylanilinium chloride finds applications in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling 4-Amino-N,N-diethyl-3-methylanilinium chloride (CAS: 2051-79-8)?

When handling 4-Amino-N,N-diethyl-3-methylanilinium chloride, it is important to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...