Compound Q&A

What precautions should be taken when handling trans-1,2-Cyclohexanediaminetetraacetic acid (CAS: 13291-61-7)?

Answer

trans-1,2-Cyclohexanediaminetetraacetic acid
When handling trans-1,2-Cyclohexanediaminetetraacetic acid (CDTA, CAS: 13291-61-7), it is crucial to follow proper laboratory safety guidelines. Wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Store CDTA in a dry, well-ventilated area to prevent moisture absorption. Use a fume hood during handling to avoid inhalation. In case of spill, neutralize the spill with an appropriate chemical and dispose of according to local regulations. Always consult the Material Safety Data Sheet (MSDS) for detailed safety information.

About

CAS No 13291-61-7
English Name trans-1,2-Cyclohexanediaminetetraacetic acid
Molecular Formula C14H22N2O8
Molecular Weight 346.33 g/mol
SMILES OC(=O)CN([C@@H]1CCCC[C@H]1N(CC(=O)O)CC(=O)O)CC(=O)O
InChIKey FCKYPQBAHLOOJQ-NXEZZACHSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of trans-1,2-Cyclohexanediaminetetraacetic acid (CAS: 13291-61-7)?

Trans-1,2-Cyclohexanediaminetetraacetic acid (CDTA, CAS: 13291-61-7) is a crystalline solid with a m...

Compound Q&A

How is trans-1,2-Cyclohexanediaminetetraacetic acid (CAS: 13291-61-7) typically synthesized?

Trans-1,2-Cyclohexanediaminetetraacetic acid (CDTA, CAS: 13291-61-7) is typically synthesized throug...

Compound Q&A

What industries use trans-1,2-Cyclohexanediaminetetraacetic acid (CAS: 13291-61-7)?

Trans-1,2-Cyclohexanediaminetetraacetic acid (CDTA, CAS: 13291-61-7) is widely used across various i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...