Compound Q&A

What industries use trans-1,2-Cyclohexanediaminetetraacetic acid (CAS: 13291-61-7)?

Answer

trans-1,2-Cyclohexanediaminetetraacetic acid
Trans-1,2-Cyclohexanediaminetetraacetic acid (CDTA, CAS: 13291-61-7) is widely used across various industries. It is a key component in pharmaceuticals for the stabilization of active ingredients, in polymers for enhancing performance, in sensors for metal ion detection, and in semiconductors for the removal of impurities. Additionally, CDTA is used in environmental remediation for the removal of heavy metals from contaminated sites.

About

CAS No 13291-61-7
English Name trans-1,2-Cyclohexanediaminetetraacetic acid
Molecular Formula C14H22N2O8
Molecular Weight 346.33 g/mol
SMILES OC(=O)CN([C@@H]1CCCC[C@H]1N(CC(=O)O)CC(=O)O)CC(=O)O
InChIKey FCKYPQBAHLOOJQ-NXEZZACHSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of trans-1,2-Cyclohexanediaminetetraacetic acid (CAS: 13291-61-7)?

Trans-1,2-Cyclohexanediaminetetraacetic acid (CDTA, CAS: 13291-61-7) is a crystalline solid with a m...

Compound Q&A

How is trans-1,2-Cyclohexanediaminetetraacetic acid (CAS: 13291-61-7) typically synthesized?

Trans-1,2-Cyclohexanediaminetetraacetic acid (CDTA, CAS: 13291-61-7) is typically synthesized throug...

Compound Q&A

What precautions should be taken when handling trans-1,2-Cyclohexanediaminetetraacetic acid (CAS: 13291-61-7)?

When handling trans-1,2-Cyclohexanediaminetetraacetic acid (CDTA, CAS: 13291-61-7), it is crucial to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...