Compound Q&A

What are the physical and chemical properties of trans-1,2-Cyclohexanediaminetetraacetic acid (CAS: 13291-61-7)?

Answer

trans-1,2-Cyclohexanediaminetetraacetic acid
Trans-1,2-Cyclohexanediaminetetraacetic acid (CDTA, CAS: 13291-61-7) is a crystalline solid with a molecular weight of approximately 276.26 g/mol. It has a high solubility in water, with a solubility of about 100 g/L at 20°C. CDTA is known for its chelating properties and reactivity towards various metal ions, making it useful in complexometric titrations and as a stabilizer in aqueous solutions.

About

CAS No 13291-61-7
English Name trans-1,2-Cyclohexanediaminetetraacetic acid
Molecular Formula C14H22N2O8
Molecular Weight 346.33 g/mol
SMILES OC(=O)CN([C@@H]1CCCC[C@H]1N(CC(=O)O)CC(=O)O)CC(=O)O
InChIKey FCKYPQBAHLOOJQ-NXEZZACHSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is trans-1,2-Cyclohexanediaminetetraacetic acid (CAS: 13291-61-7) typically synthesized?

Trans-1,2-Cyclohexanediaminetetraacetic acid (CDTA, CAS: 13291-61-7) is typically synthesized throug...

Compound Q&A

What industries use trans-1,2-Cyclohexanediaminetetraacetic acid (CAS: 13291-61-7)?

Trans-1,2-Cyclohexanediaminetetraacetic acid (CDTA, CAS: 13291-61-7) is widely used across various i...

Compound Q&A

What precautions should be taken when handling trans-1,2-Cyclohexanediaminetetraacetic acid (CAS: 13291-61-7)?

When handling trans-1,2-Cyclohexanediaminetetraacetic acid (CDTA, CAS: 13291-61-7), it is crucial to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...