Compound Q&A

What industries use 6-hydroxy-5-nitro-pyridine-3-carboxylic acid (CAS: 6635-31-0)?

Answer

6-hydroxy-5-nitro-pyridine-3-carboxylic acid
6-hydroxy-5-nitro-pyridine-3-carboxylic acid (CAS: 6635-31-0) is used in the pharmaceutical industry for the synthesis of certain medicinals and in the chemical industry for the development of sensors and semiconductors. It is also explored in the polymer industry for the production of specific polymers and composites.

About

CAS No 6635-31-0
English Name 6-hydroxy-5-nitro-pyridine-3-carboxylic acid
Molecular Formula C6H4N2O5
Molecular Weight 184.11 g/mol
SMILES C1=C(C(=O)NC=C1C(=O)O)[N+](=O)[O-]
InChIKey VJMXJGVEVASJOD-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-hydroxy-5-nitro-pyridine-3-carboxylic acid (CAS: 6635-31-0)?

6-hydroxy-5-nitro-pyridine-3-carboxylic acid (CAS: 6635-31-0) is a crystalline solid with a molecula...

Compound Q&A

How is 6-hydroxy-5-nitro-pyridine-3-carboxylic acid (CAS: 6635-31-0) typically synthesized?

6-hydroxy-5-nitro-pyridine-3-carboxylic acid (CAS: 6635-31-0) is typically synthesized through the n...

Compound Q&A

What precautions should be taken when handling 6-hydroxy-5-nitro-pyridine-3-carboxylic acid (CAS: 6635-31-0)?

When handling 6-hydroxy-5-nitro-pyridine-3-carboxylic acid (CAS: 6635-31-0), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...