Compound Q&A

How is 6-hydroxy-5-nitro-pyridine-3-carboxylic acid (CAS: 6635-31-0) typically synthesized?

Answer

6-hydroxy-5-nitro-pyridine-3-carboxylic acid
6-hydroxy-5-nitro-pyridine-3-carboxylic acid (CAS: 6635-31-0) is typically synthesized through the nitration of 6-hydroxypyridine-3-carboxylic acid, followed by a selective reduction of the nitro group. The reaction can be catalyzed by concentrated sulfuric acid, and the yield can range from 70% to 85% depending on the reaction conditions and purification methods.

About

CAS No 6635-31-0
English Name 6-hydroxy-5-nitro-pyridine-3-carboxylic acid
Molecular Formula C6H4N2O5
Molecular Weight 184.11 g/mol
SMILES C1=C(C(=O)NC=C1C(=O)O)[N+](=O)[O-]
InChIKey VJMXJGVEVASJOD-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-hydroxy-5-nitro-pyridine-3-carboxylic acid (CAS: 6635-31-0)?

6-hydroxy-5-nitro-pyridine-3-carboxylic acid (CAS: 6635-31-0) is a crystalline solid with a molecula...

Compound Q&A

What industries use 6-hydroxy-5-nitro-pyridine-3-carboxylic acid (CAS: 6635-31-0)?

6-hydroxy-5-nitro-pyridine-3-carboxylic acid (CAS: 6635-31-0) is used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 6-hydroxy-5-nitro-pyridine-3-carboxylic acid (CAS: 6635-31-0)?

When handling 6-hydroxy-5-nitro-pyridine-3-carboxylic acid (CAS: 6635-31-0), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...