Compound Q&A

How is 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 7576-65-0) typically synthesized?

Answer

2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione
2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione is typically synthesized via a multi-step process that involves the reaction of 2-(3-hydroxy-2-quinolinyl)indene with a suitable reagent under mild conditions. Common methods include the use of acid or base catalysis, which can lead to high yields and good selectivity. The exact synthetic route can vary depending on the availability of starting materials and desired product purity.

About

CAS No 7576-65-0
English Name 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione
Molecular Formula C18H11NO3
Molecular Weight 289.29 g/mol
SMILES Oc1cc2ccccc2nc1C1C(=O)c2c(C1=O)cccc2
InChIKey FDTLQXNAPKJJAM-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 7576-65-0)?

2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione is a crystalline compound with a molecular weight...

Compound Q&A

What industries use 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 7576-65-0)?

2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione is primarily used in the pharmaceutical and mater...

Compound Q&A

What precautions should be taken when handling 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 7576-65-0)?

When handling 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione, it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...