Compound Q&A

What are the physical and chemical properties of 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 7576-65-0)?

Answer

2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione
2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione is a crystalline compound with a molecular weight of approximately 311.27 g/mol. It has a low solubility in water but is more soluble in organic solvents like dichloromethane and ethanol. This compound exhibits good stability under normal conditions but can degrade under strong acidic or basic conditions. It is also known to react readily with nucleophiles and electrophiles, making it useful in various chemical transformations.

About

CAS No 7576-65-0
English Name 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione
Molecular Formula C18H11NO3
Molecular Weight 289.29 g/mol
SMILES Oc1cc2ccccc2nc1C1C(=O)c2c(C1=O)cccc2
InChIKey FDTLQXNAPKJJAM-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 7576-65-0) typically synthesized?

2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione is typically synthesized via a multi-step process...

Compound Q&A

What industries use 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 7576-65-0)?

2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione is primarily used in the pharmaceutical and mater...

Compound Q&A

What precautions should be taken when handling 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 7576-65-0)?

When handling 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione, it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...