Compound Q&A

What industries use 2-Amino-3-nitrophenol (CAS: 603-85-0)?

Answer

2-Amino-3-nitrophenol
2-Amino-3-nitrophenol (CAS: 603-85-0) is used in various industries, including pharmaceuticals, where it serves as an intermediate for the synthesis of certain drugs. It is also used in the production of dyes and pigments, as well as in environmental monitoring for the detection of pollutants.

About

CAS No 603-85-0
English Name 2-Amino-3-nitrophenol
Molecular Formula C6H6N2O3
Molecular Weight 154.12 g/mol
SMILES c1cc(c(c(c1)O)N)[N+](=O)[O-]
InChIKey KUCWUAFNGCMZDB-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-3-nitrophenol (CAS: 603-85-0)?

2-Amino-3-nitrophenol (CAS: 603-85-0) is a white crystalline solid with a molecular weight of 158.07...

Compound Q&A

How is 2-Amino-3-nitrophenol (CAS: 603-85-0) typically synthesized?

2-Amino-3-nitrophenol (CAS: 603-85-0) is commonly synthesized by nitration of 2-aminophenol followed...

Compound Q&A

What precautions should be taken when handling 2-Amino-3-nitrophenol (CAS: 603-85-0)?

When handling 2-Amino-3-nitrophenol (CAS: 603-85-0), it is crucial to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...