Compound Q&A

How is 2-Amino-3-nitrophenol (CAS: 603-85-0) typically synthesized?

Answer

2-Amino-3-nitrophenol
2-Amino-3-nitrophenol (CAS: 603-85-0) is commonly synthesized by nitration of 2-aminophenol followed by purification. The reaction requires careful control of temperature and pH to achieve high selectivity and yield, often using sulfuric acid as a catalyst.

About

CAS No 603-85-0
English Name 2-Amino-3-nitrophenol
Molecular Formula C6H6N2O3
Molecular Weight 154.12 g/mol
SMILES c1cc(c(c(c1)O)N)[N+](=O)[O-]
InChIKey KUCWUAFNGCMZDB-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-3-nitrophenol (CAS: 603-85-0)?

2-Amino-3-nitrophenol (CAS: 603-85-0) is a white crystalline solid with a molecular weight of 158.07...

Compound Q&A

What industries use 2-Amino-3-nitrophenol (CAS: 603-85-0)?

2-Amino-3-nitrophenol (CAS: 603-85-0) is used in various industries, including pharmaceuticals, wher...

Compound Q&A

What precautions should be taken when handling 2-Amino-3-nitrophenol (CAS: 603-85-0)?

When handling 2-Amino-3-nitrophenol (CAS: 603-85-0), it is crucial to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...