Compound Q&A

What are the physical and chemical properties of 3-[(E)-2-(4-Hydroxyphenyl)vinyl]-5-methoxyphenol (CAS: 42438-89-1)?

Answer

3-[(E)-2-(4-Hydroxyphenyl)vinyl]-5-methoxyphenol
3-[(E)-2-(4-Hydroxyphenyl)vinyl]-5-methoxyphenol (CAS: 42438-89-1) is a crystalline solid with a molecular weight of approximately 262.28 g/mol. Its solubility in water is low (1.5 g/L at 25°C), and it is moderately soluble in common organic solvents like methanol and ethanol. This compound exhibits good reactivity towards electrophilic substitution due to the presence of the phenolic hydroxyl group and the methoxy group.

About

CAS No 42438-89-1
English Name 3-[(E)-2-(4-Hydroxyphenyl)vinyl]-5-methoxyphenol
Molecular Formula C15H14O3
Molecular Weight 242.27 g/mol
SMILES COc1cc(cc(c1)O)/C=C/c2ccc(cc2)O
InChIKey KUWZXOMQXYWKBS-NSCUHMNNSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 3-[(E)-2-(4-Hydroxyphenyl)vinyl]-5-methoxyphenol (CAS: 42438-89-1) typically synthesized?

3-[(E)-2-(4-Hydroxyphenyl)vinyl]-5-methoxyphenol (CAS: 42438-89-1) is typically synthesized through ...

Compound Q&A

What industries use 3-[(E)-2-(4-Hydroxyphenyl)vinyl]-5-methoxyphenol (CAS: 42438-89-1)?

3-[(E)-2-(4-Hydroxyphenyl)vinyl]-5-methoxyphenol (CAS: 42438-89-1) is primarily used in the pharmace...

Compound Q&A

What precautions should be taken when handling 3-[(E)-2-(4-Hydroxyphenyl)vinyl]-5-methoxyphenol (CAS: 42438-89-1)?

When handling 3-[(E)-2-(4-Hydroxyphenyl)vinyl]-5-methoxyphenol (CAS: 42438-89-1), it is crucial to u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...