Compound Q&A

What precautions should be taken when handling (2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone (CAS: 915095-87-3)?

Answer

(2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone
Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat should be worn when handling this compound. Work should be conducted in a fume hood to minimize exposure. In case of a spill, it should be cleaned up with appropriate absorbents, and the area should be thoroughly washed down. Safety data sheets (SDS) should be consulted for detailed handling and disposal information.

About

English Name (2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone
Molecular Formula C17H14ClIO3
Molecular Weight 428.65 g/mol
SMILES C1COCC1OC2=CC=C(C=C2)C(=O)C3=C(C=CC(=C3)I)Cl
InChIKey WBBJCIOCSVFCNI-AWEZNQCLSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone (CAS: 915095-87-3)?

The compound has a crystalline form and a molecular weight of approximately 552.2 g/mol. It is poorl...

Compound Q&A

How is (2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone (CAS: 915095-87-3) typically synthesized?

This compound is typically synthesized through a multi-step process involving the reaction of chloro...

Compound Q&A

What industries use (2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone (CAS: 915095-87-3)?

This compound is used in the pharmaceutical industry for its potential as a precursor in drug synthe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...