Compound Q&A

How is (2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone (CAS: 915095-87-3) typically synthesized?

Answer

(2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone
This compound is typically synthesized through a multi-step process involving the reaction of chloroiodophenol, tetrahydrofuran, and an appropriate electrophile. The synthesis involves protecting and deprotecting groups to achieve the desired structure. High selectivity and yield are achieved using appropriate catalysts and conditions.

About

English Name (2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone
Molecular Formula C17H14ClIO3
Molecular Weight 428.65 g/mol
SMILES C1COCC1OC2=CC=C(C=C2)C(=O)C3=C(C=CC(=C3)I)Cl
InChIKey WBBJCIOCSVFCNI-AWEZNQCLSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone (CAS: 915095-87-3)?

The compound has a crystalline form and a molecular weight of approximately 552.2 g/mol. It is poorl...

Compound Q&A

What industries use (2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone (CAS: 915095-87-3)?

This compound is used in the pharmaceutical industry for its potential as a precursor in drug synthe...

Compound Q&A

What precautions should be taken when handling (2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone (CAS: 915095-87-3)?

Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat should be worn ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...