Compound Q&A

What are the physical and chemical properties of (2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone (CAS: 915095-87-3)?

Answer

(2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone
The compound has a crystalline form and a molecular weight of approximately 552.2 g/mol. It is poorly soluble in water but soluble in organic solvents like methanol and acetonitrile. Chemically, it is less reactive, showing limited reactivity in typical organic reactions and exhibits good stability under normal storage conditions.

About

English Name (2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone
Molecular Formula C17H14ClIO3
Molecular Weight 428.65 g/mol
SMILES C1COCC1OC2=CC=C(C=C2)C(=O)C3=C(C=CC(=C3)I)Cl
InChIKey WBBJCIOCSVFCNI-AWEZNQCLSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is (2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone (CAS: 915095-87-3) typically synthesized?

This compound is typically synthesized through a multi-step process involving the reaction of chloro...

Compound Q&A

What industries use (2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone (CAS: 915095-87-3)?

This compound is used in the pharmaceutical industry for its potential as a precursor in drug synthe...

Compound Q&A

What precautions should be taken when handling (2-Chloro-5-iodophenyl)(4-(((3S)-tetrahydro-3-furanyl)oxy)phenyl)methanone (CAS: 915095-87-3)?

Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat should be worn ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...