Compound Q&A

What industries use 4-Benzyl-2-hydroxy-3-morpholinone (CAS: 287930-73-8)?

Answer

4-Benzyl-2-hydroxy-3-morpholinone
4-Benzyl-2-hydroxy-3-morpholinone is primarily used in the pharmaceutical industry as an intermediate for the synthesis of certain drugs. It also finds applications in the polymer industry for the production of functionalized polymers, and in the sensor technology sector for the development of specific chemical sensors and semiconductors.

About

English Name 4-Benzyl-2-hydroxy-3-morpholinone
Molecular Formula C11H13NO3
Molecular Weight 207.22899999999998 g/mol
SMILES C1COC(C(=O)N1CC2=CC=CC=C2)O
InChIKey CAGSEMPCDRYWFN-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Benzyl-2-hydroxy-3-morpholinone (CAS: 287930-73-8)?

4-Benzyl-2-hydroxy-3-morpholinone is a crystalline compound with a molecular weight of approximately...

Compound Q&A

How is 4-Benzyl-2-hydroxy-3-morpholinone (CAS: 287930-73-8) typically synthesized?

4-Benzyl-2-hydroxy-3-morpholinone is typically synthesized via a multi-step process starting from mo...

Compound Q&A

What precautions should be taken when handling 4-Benzyl-2-hydroxy-3-morpholinone (CAS: 287930-73-8)?

When handling 4-Benzyl-2-hydroxy-3-morpholinone, it is crucial to wear appropriate personal protecti...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...