Compound Q&A

How is 4-Benzyl-2-hydroxy-3-morpholinone (CAS: 287930-73-8) typically synthesized?

Answer

4-Benzyl-2-hydroxy-3-morpholinone
4-Benzyl-2-hydroxy-3-morpholinone is typically synthesized via a multi-step process starting from morpholine and benzyl alcohol. The reaction involves the formation of an ester intermediate, followed by hydrolysis and deprotection. This process requires the use of appropriate solvents and mild basic conditions to achieve high yield and selectivity.

About

English Name 4-Benzyl-2-hydroxy-3-morpholinone
Molecular Formula C11H13NO3
Molecular Weight 207.22899999999998 g/mol
SMILES C1COC(C(=O)N1CC2=CC=CC=C2)O
InChIKey CAGSEMPCDRYWFN-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Benzyl-2-hydroxy-3-morpholinone (CAS: 287930-73-8)?

4-Benzyl-2-hydroxy-3-morpholinone is a crystalline compound with a molecular weight of approximately...

Compound Q&A

What industries use 4-Benzyl-2-hydroxy-3-morpholinone (CAS: 287930-73-8)?

4-Benzyl-2-hydroxy-3-morpholinone is primarily used in the pharmaceutical industry as an intermediat...

Compound Q&A

What precautions should be taken when handling 4-Benzyl-2-hydroxy-3-morpholinone (CAS: 287930-73-8)?

When handling 4-Benzyl-2-hydroxy-3-morpholinone, it is crucial to wear appropriate personal protecti...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...