Compound Q&A

What industries use 4,6-Dichloro-5-nitropyrimidine (CAS: 4316-93-2)?

Answer

4,6-Dichloro-5-nitropyrimidine
4,6-Dichloro-5-nitropyrimidine is used primarily in the pharmaceutical industry for the synthesis of certain drugs. It is also applied in the agricultural sector as a herbicide intermediate. Additionally, it has potential applications in the polymer and semiconductor industries for specific chemical processes.

About

CAS No 4316-93-2
English Name 4,6-Dichloro-5-nitropyrimidine
Molecular Formula C4HCl2N3O2
Molecular Weight 193.97 g/mol
SMILES C1=NC(=C(C(=N1)Cl)[N+](=O)[O-])Cl
InChIKey HCTISZQLTGAYOX-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,6-Dichloro-5-nitropyrimidine (CAS: 4316-93-2)?

4,6-Dichloro-5-nitropyrimidine is a solid with a crystalline form. Its molecular weight is approxima...

Compound Q&A

How is 4,6-Dichloro-5-nitropyrimidine (CAS: 4316-93-2) typically synthesized?

4,6-Dichloro-5-nitropyrimidine can be synthesized via a multi-step process involving the nitration o...

Compound Q&A

What precautions should be taken when handling 4,6-Dichloro-5-nitropyrimidine (CAS: 4316-93-2)?

When handling 4,6-Dichloro-5-nitropyrimidine, it is essential to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...