Compound Q&A

What are the physical and chemical properties of 4,6-Dichloro-5-nitropyrimidine (CAS: 4316-93-2)?

Answer

4,6-Dichloro-5-nitropyrimidine
4,6-Dichloro-5-nitropyrimidine is a solid with a crystalline form. Its molecular weight is approximately 230.03 g/mol. It has low water solubility but is soluble in common organic solvents like ethanol and acetone. The compound is known for its high reactivity, particularly towards nucleophilic substitution reactions.

About

CAS No 4316-93-2
English Name 4,6-Dichloro-5-nitropyrimidine
Molecular Formula C4HCl2N3O2
Molecular Weight 193.97 g/mol
SMILES C1=NC(=C(C(=N1)Cl)[N+](=O)[O-])Cl
InChIKey HCTISZQLTGAYOX-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 4,6-Dichloro-5-nitropyrimidine (CAS: 4316-93-2) typically synthesized?

4,6-Dichloro-5-nitropyrimidine can be synthesized via a multi-step process involving the nitration o...

Compound Q&A

What industries use 4,6-Dichloro-5-nitropyrimidine (CAS: 4316-93-2)?

4,6-Dichloro-5-nitropyrimidine is used primarily in the pharmaceutical industry for the synthesis of...

Compound Q&A

What precautions should be taken when handling 4,6-Dichloro-5-nitropyrimidine (CAS: 4316-93-2)?

When handling 4,6-Dichloro-5-nitropyrimidine, it is essential to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...