Compound Q&A

What industries use Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8)?

Answer

Trimethylolpropane Triglycidyl Ether (Technical Grade)
Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8) is widely used in the polymer industry, particularly in the production of epoxy resins. It also finds applications in the pharmaceutical industry for the synthesis of certain polymers used in drug delivery systems. Additionally, it is utilized in the electronics industry for encapsulation and potting applications, and in the manufacturing of sensors and semiconductors.

About

CAS No 30499-70-8
English Name Trimethylolpropane Triglycidyl Ether (Technical Grade)
Molecular Formula C15H26O6
Molecular Weight 302.36 g/mol
SMILES CCC(COCC1CO1)(COCC2CO2)COCC3CO3
InChIKey QECCQGLIYMMHCR-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8)?

Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8) is a colorless to slightly yellowish liquid w...

Compound Q&A

How is Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8) typically synthesized?

Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8) is typically synthesized through the epoxidat...

Compound Q&A

What precautions should be taken when handling Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8)?

When handling Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8), safety is paramount. It is rec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...