Compound Q&A

How is Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8) typically synthesized?

Answer

Trimethylolpropane Triglycidyl Ether (Technical Grade)
Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8) is typically synthesized through the epoxidation of trimethylolpropane followed by the addition of epoxy groups. This process often involves the use of peroxyacids as catalysts. The reaction is carefully controlled to achieve high selectivity and yield, with the goal of forming a triglycidyl ether structure.

About

CAS No 30499-70-8
English Name Trimethylolpropane Triglycidyl Ether (Technical Grade)
Molecular Formula C15H26O6
Molecular Weight 302.36 g/mol
SMILES CCC(COCC1CO1)(COCC2CO2)COCC3CO3
InChIKey QECCQGLIYMMHCR-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8)?

Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8) is a colorless to slightly yellowish liquid w...

Compound Q&A

What industries use Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8)?

Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8) is widely used in the polymer industry, parti...

Compound Q&A

What precautions should be taken when handling Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8)?

When handling Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8), safety is paramount. It is rec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...