Compound Q&A

What are the physical and chemical properties of Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8)?

Answer

Trimethylolpropane Triglycidyl Ether (Technical Grade)
Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8) is a colorless to slightly yellowish liquid with a strong odor. It has a molecular weight of approximately 328 g/mol. This compound has excellent solubility in organic solvents like toluene and xylene but is poorly soluble in water. It exhibits good reactivity towards various functional groups, making it a versatile crosslinking agent in epoxy resins.

About

CAS No 30499-70-8
English Name Trimethylolpropane Triglycidyl Ether (Technical Grade)
Molecular Formula C15H26O6
Molecular Weight 302.36 g/mol
SMILES CCC(COCC1CO1)(COCC2CO2)COCC3CO3
InChIKey QECCQGLIYMMHCR-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8) typically synthesized?

Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8) is typically synthesized through the epoxidat...

Compound Q&A

What industries use Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8)?

Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8) is widely used in the polymer industry, parti...

Compound Q&A

What precautions should be taken when handling Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8)?

When handling Trimethylolpropane Triglycidyl Ether (CAS: 30499-70-8), safety is paramount. It is rec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...