Compound Q&A

What precautions should be taken when handling Alvocidib (CAS: 146426-40-6)?

Answer

Alvocidib (Flavopiridol)
When handling Alvocidib (CAS: 146426-40-6), ensure proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated fume hood to avoid inhalation risks. Always refer to the Safety Data Sheet (SDS) for detailed spill and disposal instructions.

About

English Name Alvocidib (Flavopiridol)
Molecular Formula C21H20ClNO5
Molecular Weight 401.85 g/mol
SMILES CN1CCC(C(C1)O)C2=C(C=C(C3=C2OC(=CC3=O)C4=CC=CC=C4Cl)O)O
InChIKey BIIVYFLTOXDAOV-YVEFUNNKSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Alvocidib (CAS: 146426-40-6)?

Alvocidib (CAS: 146426-40-6) is a water-soluble compound with a molecular weight of approximately 40...

Compound Q&A

How is Alvocidib (CAS: 146426-40-6) typically synthesized?

Alvocidib (CAS: 146426-40-6) is synthesized through a multi-step process involving condensation, red...

Compound Q&A

What industries use Alvocidib (CAS: 146426-40-6)?

Alvocidib (CAS: 146426-40-6) is primarily used in the pharmaceutical industry for its antiproliferat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...