Compound Q&A

What industries use 2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide (CAS: 475086-01-2)?

Answer

2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide
This compound is primarily used in pharmaceuticals and research due to its structural complexity and potential biological activity. It may also have applications in the development of sensors and other advanced materials, although its specific uses in these fields are limited.

About

English Name 2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide
Molecular Formula C26H32N4O4S
Molecular Weight 496.63 g/mol
SMILES CC(C)N(CCCCOCC(=O)NS(=O)(=O)C)c1cnc(c2ccccc2)c(n1)c3ccccc3
InChIKey QXWZQTURMXZVHJ-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide (CAS: 475086-01-2)?

This compound is a white or off-white crystalline solid with a molecular weight of approximately 569...

Compound Q&A

How is 2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide (CAS: 475086-01-2) typically synthesized?

This compound can be synthesized via a multi-step process involving amidation of an intermediate pyr...

Compound Q&A

What precautions should be taken when handling 2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide (CAS: 475086-01-2)?

Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat is required whe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...