Compound Q&A

How is 2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide (CAS: 475086-01-2) typically synthesized?

Answer

2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide
This compound can be synthesized via a multi-step process involving amidation of an intermediate pyrazine derivative with an amino acid derivative. The reaction typically requires a coupling agent and a base. High yield can be achieved with optimized conditions. The process involves careful control of temperature and pH to ensure selectivity and purity.

About

English Name 2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide
Molecular Formula C26H32N4O4S
Molecular Weight 496.63 g/mol
SMILES CC(C)N(CCCCOCC(=O)NS(=O)(=O)C)c1cnc(c2ccccc2)c(n1)c3ccccc3
InChIKey QXWZQTURMXZVHJ-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide (CAS: 475086-01-2)?

This compound is a white or off-white crystalline solid with a molecular weight of approximately 569...

Compound Q&A

What industries use 2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide (CAS: 475086-01-2)?

This compound is primarily used in pharmaceuticals and research due to its structural complexity and...

Compound Q&A

What precautions should be taken when handling 2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide (CAS: 475086-01-2)?

Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat is required whe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...