Compound Q&A

What are the physical and chemical properties of 2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide (CAS: 475086-01-2)?

Answer

2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide
This compound is a white or off-white crystalline solid with a molecular weight of approximately 569.4 g/mol. It is slightly soluble in water but more soluble in organic solvents like methanol and acetonitrile. The compound shows moderate reactivity towards nucleophiles and can undergo condensation reactions. It is stable in air and light but should be stored in a cool, dark place.

About

English Name 2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide
Molecular Formula C26H32N4O4S
Molecular Weight 496.63 g/mol
SMILES CC(C)N(CCCCOCC(=O)NS(=O)(=O)C)c1cnc(c2ccccc2)c(n1)c3ccccc3
InChIKey QXWZQTURMXZVHJ-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide (CAS: 475086-01-2) typically synthesized?

This compound can be synthesized via a multi-step process involving amidation of an intermediate pyr...

Compound Q&A

What industries use 2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide (CAS: 475086-01-2)?

This compound is primarily used in pharmaceuticals and research due to its structural complexity and...

Compound Q&A

What precautions should be taken when handling 2-{4-[(5,6-Diphenyl-2-pyrazinyl)(isopropyl)amino]butoxy}-N-(methylsulfonyl)acetamide (CAS: 475086-01-2)?

Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat is required whe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...