Compound Q&A

What are the physical and chemical properties of Streptavidin (CAS: 9013-20-1)?

Answer

Streptavidin
Streptavidin (CAS: 9013-20-1) is a tetrameric protein with a molecular weight of approximately 44 kDa. It exhibits high specificity and affinity for biotin. The protein is highly soluble in water and resistant to denaturation under mild conditions. Streptavidin is known for its exceptional stability and is commonly used in various biotechnological applications due to its unique binding properties.

About

CAS No 9013-20-1
English Name Streptavidin
Molecular Formula C14H17BrClNO2S
Molecular Weight 378.7 g/mol
SMILES C1CC[N+](=C(C2=CC(=CC=C2)Cl)SCC(=O)O)CC1.[Br-]
InChIKey RTWACOLFHOBGCE-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is Streptavidin (CAS: 9013-20-1) typically synthesized?

Streptavidin (CAS: 9013-20-1) is produced through fermentation of the actinomycete Streptomyces avid...

Compound Q&A

What industries use Streptavidin (CAS: 9013-20-1)?

Streptavidin (CAS: 9013-20-1) is widely used in the pharmaceutical industry for drug delivery and di...

Compound Q&A

What precautions should be taken when handling Streptavidin (CAS: 9013-20-1)?

When handling Streptavidin (CAS: 9013-20-1), it is essential to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...