Compound Q&A

What industries use 4-(2-Phenyl-2-propanyl)phenol (CAS: 599-64-4)?

Answer

4-(2-Phenyl-2-propanyl)phenol
4-(2-Phenyl-2-propanyl)phenol is utilized in various industries due to its unique chemical properties. It is commonly used in the pharmaceutical industry as an intermediate in drug synthesis. In the polymer industry, it serves as a stabilizer and antioxidant. It is also employed in the production of sensors and semiconductors due to its electronic properties. Additionally, this compound finds applications in the cosmetic industry as a fragrance component.

About

CAS No 599-64-4
English Name 4-(2-Phenyl-2-propanyl)phenol
Molecular Formula C15H16O
Molecular Weight 212.29 g/mol
SMILES CC(C)(C1=CC=CC=C1)C2=CC=C(C=C2)O
InChIKey QBDSZLJBMIMQRS-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(2-Phenyl-2-propanyl)phenol (CAS: 599-64-4)?

4-(2-Phenyl-2-propanyl)phenol is a white to off-white crystalline solid with a molecular weight of a...

Compound Q&A

How is 4-(2-Phenyl-2-propanyl)phenol (CAS: 599-64-4) typically synthesized?

4-(2-Phenyl-2-propanyl)phenol is commonly synthesized through a multistep process involving the reac...

Compound Q&A

What precautions should be taken when handling 4-(2-Phenyl-2-propanyl)phenol (CAS: 599-64-4)?

When handling 4-(2-Phenyl-2-propanyl)phenol, it is essential to follow strict safety protocols. Alwa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...