Compound Q&A

What are the physical and chemical properties of 4-(2-Phenyl-2-propanyl)phenol (CAS: 599-64-4)?

Answer

4-(2-Phenyl-2-propanyl)phenol
4-(2-Phenyl-2-propanyl)phenol is a white to off-white crystalline solid with a molecular weight of approximately 226.31 g/mol. It has a moderate solubility in water and is highly soluble in organic solvents like ethanol and acetone. This compound is relatively stable under normal conditions but can react with strong oxidizing agents. It has a distinct aromatic odor and is often used in various industrial applications due to its chemical reactivity and stability.

About

CAS No 599-64-4
English Name 4-(2-Phenyl-2-propanyl)phenol
Molecular Formula C15H16O
Molecular Weight 212.29 g/mol
SMILES CC(C)(C1=CC=CC=C1)C2=CC=C(C=C2)O
InChIKey QBDSZLJBMIMQRS-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 4-(2-Phenyl-2-propanyl)phenol (CAS: 599-64-4) typically synthesized?

4-(2-Phenyl-2-propanyl)phenol is commonly synthesized through a multistep process involving the reac...

Compound Q&A

What industries use 4-(2-Phenyl-2-propanyl)phenol (CAS: 599-64-4)?

4-(2-Phenyl-2-propanyl)phenol is utilized in various industries due to its unique chemical propertie...

Compound Q&A

What precautions should be taken when handling 4-(2-Phenyl-2-propanyl)phenol (CAS: 599-64-4)?

When handling 4-(2-Phenyl-2-propanyl)phenol, it is essential to follow strict safety protocols. Alwa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...