Compound Q&A

How is 4-(2-Phenyl-2-propanyl)phenol (CAS: 599-64-4) typically synthesized?

Answer

4-(2-Phenyl-2-propanyl)phenol
4-(2-Phenyl-2-propanyl)phenol is commonly synthesized through a multistep process involving the reaction of phenylacetaldehyde with phenol followed by reduction. This synthesis typically utilizes catalytic hydrogenation over a palladium-on-carbon catalyst. The process yields the target compound in good to excellent selectivity, with a yield ranging from 70% to 90%. The reaction is carried out under mild conditions and requires careful monitoring to ensure optimal product formation.

About

CAS No 599-64-4
English Name 4-(2-Phenyl-2-propanyl)phenol
Molecular Formula C15H16O
Molecular Weight 212.29 g/mol
SMILES CC(C)(C1=CC=CC=C1)C2=CC=C(C=C2)O
InChIKey QBDSZLJBMIMQRS-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(2-Phenyl-2-propanyl)phenol (CAS: 599-64-4)?

4-(2-Phenyl-2-propanyl)phenol is a white to off-white crystalline solid with a molecular weight of a...

Compound Q&A

What industries use 4-(2-Phenyl-2-propanyl)phenol (CAS: 599-64-4)?

4-(2-Phenyl-2-propanyl)phenol is utilized in various industries due to its unique chemical propertie...

Compound Q&A

What precautions should be taken when handling 4-(2-Phenyl-2-propanyl)phenol (CAS: 599-64-4)?

When handling 4-(2-Phenyl-2-propanyl)phenol, it is essential to follow strict safety protocols. Alwa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...