Compound Q&A

What industries use Acetylcorynoline (CAS: 18797-80-3)?

Answer

Acetylcorynoline
Acetylcorynoline (CAS: 18797-80-3) is utilized in various industries, primarily in pharmaceuticals due to its biological activity. It is also explored in the field of natural products chemistry for its potential as a lead compound. Additionally, it may have applications in the development of new materials and sensors, though its use in these areas is less common and more research-based.

About

CAS No 18797-80-3
English Name Acetylcorynoline
Molecular Formula C23H23NO6
Molecular Weight 409.43 g/mol
SMILES CC(=O)OC1Cc2cc3OCOc3cc2C2C1(C)c1ccc3c(c1CN2C)OCO3
InChIKey PUHCFWFODBLSAP-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Acetylcorynoline (CAS: 18797-80-3)?

Acetylcorynoline (CAS: 18797-80-3) is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

How is Acetylcorynoline (CAS: 18797-80-3) typically synthesized?

Acetylcorynoline (CAS: 18797-80-3) is commonly synthesized through a route involving the acetylation...

Compound Q&A

What precautions should be taken when handling Acetylcorynoline (CAS: 18797-80-3)?

When handling Acetylcorynoline (CAS: 18797-80-3), it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...