Compound Q&A

What are the physical and chemical properties of Acetylcorynoline (CAS: 18797-80-3)?

Answer

Acetylcorynoline
Acetylcorynoline (CAS: 18797-80-3) is a crystalline compound with a molecular weight of approximately 254.31 g/mol. It has a solubility of about 0.2 mg/mL in water and is slightly soluble in ethanol. Chemically, it is relatively stable but can react with strong acids or bases. It is an amphoteric compound with potential for both acidic and basic behavior.

About

CAS No 18797-80-3
English Name Acetylcorynoline
Molecular Formula C23H23NO6
Molecular Weight 409.43 g/mol
SMILES CC(=O)OC1Cc2cc3OCOc3cc2C2C1(C)c1ccc3c(c1CN2C)OCO3
InChIKey PUHCFWFODBLSAP-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is Acetylcorynoline (CAS: 18797-80-3) typically synthesized?

Acetylcorynoline (CAS: 18797-80-3) is commonly synthesized through a route involving the acetylation...

Compound Q&A

What industries use Acetylcorynoline (CAS: 18797-80-3)?

Acetylcorynoline (CAS: 18797-80-3) is utilized in various industries, primarily in pharmaceuticals d...

Compound Q&A

What precautions should be taken when handling Acetylcorynoline (CAS: 18797-80-3)?

When handling Acetylcorynoline (CAS: 18797-80-3), it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...