Compound Q&A

What precautions should be taken when handling Benzenesulfonic acid hydrate (1:1) (CAS: 26158-00-9)?

Answer

Benzenesulfonic acid hydrate (1:1)
When handling Benzenesulfonic acid hydrate (1:1), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, lab coat, and safety goggles. Use a fume hood during preparation and storage to minimize exposure to vapors. Store the compound in a cool, dry place away from direct sunlight and heat sources. In case of spill, use appropriate cleanup materials and consult the Safety Data Sheet (SDS) for detailed instructions.

About

CAS No 26158-00-9
English Name Benzenesulfonic acid hydrate (1:1)
Molecular Formula C6H8O4S
Molecular Weight 176.19299999999996 g/mol
SMILES C1=CC=C(C=C1)S(=O)(=O)O.O
InChIKey MVIOINXPSFUJEN-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzenesulfonic acid hydrate (1:1) (CAS: 26158-00-9)?

Benzenesulfonic acid hydrate (1:1) is a crystalline solid with a molecular weight of approximately 1...

Compound Q&A

How is Benzenesulfonic acid hydrate (1:1) (CAS: 26158-00-9) typically synthesized?

Benzenesulfonic acid hydrate (1:1) is typically synthesized by sulfonation of benzene and subsequent...

Compound Q&A

What industries use Benzenesulfonic acid hydrate (1:1) (CAS: 26158-00-9)?

Benzenesulfonic acid hydrate (1:1) is used in pharmaceuticals, primarily as a raw material for synth...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...