Compound Q&A

How is Benzenesulfonic acid hydrate (1:1) (CAS: 26158-00-9) typically synthesized?

Answer

Benzenesulfonic acid hydrate (1:1)
Benzenesulfonic acid hydrate (1:1) is typically synthesized by sulfonation of benzene and subsequent hydration. The sulfonation step is catalyzed by concentrated sulfuric acid, and the hydration can be achieved using water or other solvents under various conditions. The process requires careful control of temperature and concentration to achieve high yield and selectivity.

About

CAS No 26158-00-9
English Name Benzenesulfonic acid hydrate (1:1)
Molecular Formula C6H8O4S
Molecular Weight 176.19 g/mol
SMILES C1=CC=C(C=C1)S(=O)(=O)O.O
InChIKey MVIOINXPSFUJEN-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzenesulfonic acid hydrate (1:1) (CAS: 26158-00-9)?

Benzenesulfonic acid hydrate (1:1) is a crystalline solid with a molecular weight of approximately 1...

Compound Q&A

What industries use Benzenesulfonic acid hydrate (1:1) (CAS: 26158-00-9)?

Benzenesulfonic acid hydrate (1:1) is used in pharmaceuticals, primarily as a raw material for synth...

Compound Q&A

What precautions should be taken when handling Benzenesulfonic acid hydrate (1:1) (CAS: 26158-00-9)?

When handling Benzenesulfonic acid hydrate (1:1), it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...