Compound Q&A

What are the physical and chemical properties of Benzenesulfonic acid hydrate (1:1) (CAS: 26158-00-9)?

Answer

Benzenesulfonic acid hydrate (1:1)
Benzenesulfonic acid hydrate (1:1) is a crystalline solid with a molecular weight of approximately 176.14 g/mol. It has a pKa of about 2.9 and is slightly soluble in water. The compound is reactive towards nucleophiles and can act as an acid in aqueous solutions. It melts at around 165°C and is stable under normal conditions.

About

CAS No 26158-00-9
English Name Benzenesulfonic acid hydrate (1:1)
Molecular Formula C6H8O4S
Molecular Weight 176.19299999999996 g/mol
SMILES C1=CC=C(C=C1)S(=O)(=O)O.O
InChIKey MVIOINXPSFUJEN-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is Benzenesulfonic acid hydrate (1:1) (CAS: 26158-00-9) typically synthesized?

Benzenesulfonic acid hydrate (1:1) is typically synthesized by sulfonation of benzene and subsequent...

Compound Q&A

What industries use Benzenesulfonic acid hydrate (1:1) (CAS: 26158-00-9)?

Benzenesulfonic acid hydrate (1:1) is used in pharmaceuticals, primarily as a raw material for synth...

Compound Q&A

What precautions should be taken when handling Benzenesulfonic acid hydrate (1:1) (CAS: 26158-00-9)?

When handling Benzenesulfonic acid hydrate (1:1), it is essential to wear appropriate personal prote...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...