Compound Q&A

How is 2-Amino-3-bromo-5-nitrobenzonitrile (CAS: 17601-94-4) typically synthesized?

Answer

2-Amino-3-bromo-5-nitrobenzonitrile
2-Amino-3-bromo-5-nitrobenzonitrile is commonly synthesized through the bromination of 2-amino-5-nitrobenzonitrile followed by nitration. The reaction typically involves the use of bromine in the presence of a Lewis acid like aluminum trichloride, and nitric acid with sulfuric acid as an oxidizing agent, with careful control of reaction conditions to achieve high yield and selectivity.

About

CAS No 17601-94-4
English Name 2-Amino-3-bromo-5-nitrobenzonitrile
Molecular Formula C7H4BrN3O2
Molecular Weight 242.03 g/mol
SMILES C1=C(C=C(C(=C1C#N)N)Br)[N+](=O)[O-]
InChIKey MUHLVSZIVTURCZ-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-3-bromo-5-nitrobenzonitrile (CAS: 17601-94-4)?

2-Amino-3-bromo-5-nitrobenzonitrile is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

What industries use 2-Amino-3-bromo-5-nitrobenzonitrile (CAS: 17601-94-4)?

2-Amino-3-bromo-5-nitrobenzonitrile is used primarily in the pharmaceutical industry for the synthes...

Compound Q&A

What precautions should be taken when handling 2-Amino-3-bromo-5-nitrobenzonitrile (CAS: 17601-94-4)?

When handling 2-Amino-3-bromo-5-nitrobenzonitrile, it is essential to use personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...