Compound Q&A

What are the physical and chemical properties of 2-Amino-3-bromo-5-nitrobenzonitrile (CAS: 17601-94-4)?

Answer

2-Amino-3-bromo-5-nitrobenzonitrile
2-Amino-3-bromo-5-nitrobenzonitrile is a crystalline solid with a molecular weight of approximately 276.02 g/mol. It is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. Chemically, it shows reactivity towards nucleophiles, electrophiles, and reducing agents, making it useful in various organic synthesis reactions.

About

CAS No 17601-94-4
English Name 2-Amino-3-bromo-5-nitrobenzonitrile
Molecular Formula C7H4BrN3O2
Molecular Weight 242.03 g/mol
SMILES C1=C(C=C(C(=C1C#N)N)Br)[N+](=O)[O-]
InChIKey MUHLVSZIVTURCZ-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is 2-Amino-3-bromo-5-nitrobenzonitrile (CAS: 17601-94-4) typically synthesized?

2-Amino-3-bromo-5-nitrobenzonitrile is commonly synthesized through the bromination of 2-amino-5-nit...

Compound Q&A

What industries use 2-Amino-3-bromo-5-nitrobenzonitrile (CAS: 17601-94-4)?

2-Amino-3-bromo-5-nitrobenzonitrile is used primarily in the pharmaceutical industry for the synthes...

Compound Q&A

What precautions should be taken when handling 2-Amino-3-bromo-5-nitrobenzonitrile (CAS: 17601-94-4)?

When handling 2-Amino-3-bromo-5-nitrobenzonitrile, it is essential to use personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...